C24H44N6 — CID 111719896
1-[3-[benzyl(methyl)amino]butyl]-3-ethyl-2-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine (PubChem CID 111719896) has the molecular formula C24H44N6 and a molecular weight of 416.66 g/mol. Its IUPAC name is 1-[3-[benzyl(methyl)amino]butyl]-3-ethyl-2-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine.
| Compound Name | 1-[3-[benzyl(methyl)amino]butyl]-3-ethyl-2-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111719896 |
| Molecular Formula | C24H44N6 |
| Molecular Weight | 416.66 g/mol |
| Exact Mass | 416.36 |
| IUPAC Name | 1-[3-[benzyl(methyl)amino]butyl]-3-ethyl-2-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCN1CCCN(C)CC1)NCCC(C)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C24H44N6/c1-5-25-24(26-14-9-17-30-18-10-16-28(3)19-20-30)27-15-13-22(2)29(4)21-23-11-7-6-8-12-23/h6-8,11-12,22H,5,9-10,13-21H2,1-4H3,(H2,25,26,27) |
| InChIKey | DKTYKKSCRADRFW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 46.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.66 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|