C12H24IN3O2S — CID 111722110
1-(cyclobutylmethyl)-2-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]guanidine;hydroiodide (PubChem CID 111722110) has the molecular formula C12H24IN3O2S and a molecular weight of 401.31 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-2-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(cyclobutylmethyl)-2-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111722110 |
| Molecular Formula | C12H24IN3O2S |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 1-(cyclobutylmethyl)-2-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]guanidine;hydroiodide |
| SMILES | CS(=O)(=O)CC1(C/N=C(\N)NCC2CCC2)CC1.I |
| InChI | InChI=1S/C12H23N3O2S.HI/c1-18(16,17)9-12(5-6-12)8-15-11(13)14-7-10-3-2-4-10;/h10H,2-9H2,1H3,(H3,13,14,15);1H |
| InChIKey | ZWWVQAPZRVDIQV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|