C22H24N4 — CID 111722699
N'-methyl-3-phenyl-N-(quinolin-8-ylmethyl)pyrrolidine-1-carboximidamide (PubChem CID 111722699) has the molecular formula C22H24N4 and a molecular weight of 344.46 g/mol. Its IUPAC name is N'-methyl-3-phenyl-N-(quinolin-8-ylmethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-3-phenyl-N-(quinolin-8-ylmethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111722699 |
| Molecular Formula | C22H24N4 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | N'-methyl-3-phenyl-N-(quinolin-8-ylmethyl)pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1cccc2cccnc12)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C22H24N4/c1-23-22(26-14-12-20(16-26)17-7-3-2-4-8-17)25-15-19-10-5-9-18-11-6-13-24-21(18)19/h2-11,13,20H,12,14-16H2,1H3,(H,23,25) |
| InChIKey | ANMWBRRVGBFOME-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|