C8H9BrO3 — CID 11172334
3-(bromomethyl)-4-propan-2-ylfuran-2,5-dione (PubChem CID 11172334) has the molecular formula C8H9BrO3 and a molecular weight of 233.06 g/mol. Its IUPAC name is 3-(bromomethyl)-4-propan-2-ylfuran-2,5-dione.
| Compound Name | 3-(bromomethyl)-4-propan-2-ylfuran-2,5-dione |
|---|---|
| PubChem CID | 11172334 |
| Molecular Formula | C8H9BrO3 |
| Molecular Weight | 233.06 g/mol |
| Exact Mass | 231.97 |
| IUPAC Name | 3-(bromomethyl)-4-propan-2-ylfuran-2,5-dione |
| SMILES | CC(C)C1=C(CBr)C(=O)OC1=O |
| InChI | InChI=1S/C8H9BrO3/c1-4(2)6-5(3-9)7(10)12-8(6)11/h4H,3H2,1-2H3 |
| InChIKey | VPHHLCIKXVYRQP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.06 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|