C21H40IN5O3 — CID 111728292
tert-butyl 3-[[[N-methyl-C-(3-morpholin-4-ylpyrrolidin-1-yl)carbonimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide (PubChem CID 111728292) has the molecular formula C21H40IN5O3 and a molecular weight of 537.49 g/mol. Its IUPAC name is tert-butyl 3-[[[N-methyl-C-(3-morpholin-4-ylpyrrolidin-1-yl)carbonimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[[N-methyl-C-(3-morpholin-4-ylpyrrolidin-1-yl)carbonimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111728292 |
| Molecular Formula | C21H40IN5O3 |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | tert-butyl 3-[[[N-methyl-C-(3-morpholin-4-ylpyrrolidin-1-yl)carbonimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide |
| SMILES | C/N=C(/NCC1CCCN(C(=O)OC(C)(C)C)C1)N1CCC(N2CCOCC2)C1.I |
| InChI | InChI=1S/C21H39N5O3.HI/c1-21(2,3)29-20(27)26-8-5-6-17(15-26)14-23-19(22-4)25-9-7-18(16-25)24-10-12-28-13-11-24;/h17-18H,5-16H2,1-4H3,(H,22,23);1H |
| InChIKey | SJXCOPWHHSGENY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|