C23H29IN4OS — CID 111731604
N-[3-(1,3-benzothiazol-2-yl)propyl]-3-(4-methoxyphenyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111731604) has the molecular formula C23H29IN4OS and a molecular weight of 536.48 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)propyl]-3-(4-methoxyphenyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-3-(4-methoxyphenyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111731604 |
| Molecular Formula | C23H29IN4OS |
| Molecular Weight | 536.48 g/mol |
| Exact Mass | 536.11 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-3-(4-methoxyphenyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCc1nc2ccccc2s1)N1CCC(c2ccc(OC)cc2)C1.I |
| InChI | InChI=1S/C23H28N4OS.HI/c1-24-23(25-14-5-8-22-26-20-6-3-4-7-21(20)29-22)27-15-13-18(16-27)17-9-11-19(28-2)12-10-17;/h3-4,6-7,9-12,18H,5,8,13-16H2,1-2H3,(H,24,25);1H |
| InChIKey | ZKCFEVCEBXVFJB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|