C13H24IN3 — CID 111732530
N-cyclopropyl-N'-methyl-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide (PubChem CID 111732530) has the molecular formula C13H24IN3 and a molecular weight of 349.26 g/mol. Its IUPAC name is N-cyclopropyl-N'-methyl-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide.
| Compound Name | N-cyclopropyl-N'-methyl-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111732530 |
| Molecular Formula | C13H24IN3 |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-cyclopropyl-N'-methyl-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NC1CC1)N1CCC2(CCCC2)C1.I |
| InChI | InChI=1S/C13H23N3.HI/c1-14-12(15-11-4-5-11)16-9-8-13(10-16)6-2-3-7-13;/h11H,2-10H2,1H3,(H,14,15);1H |
| InChIKey | ZMRLOCMETILCTD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|