C11H13FN2O5 — CID 11173313
(2S,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-3-carbonyl fluoride (PubChem CID 11173313) has the molecular formula C11H13FN2O5 and a molecular weight of 272.23 g/mol. Its IUPAC name is (2S,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-3-carbonyl fluoride.
| Compound Name | (2S,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-3-carbonyl fluoride |
|---|---|
| PubChem CID | 11173313 |
| Molecular Formula | C11H13FN2O5 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | (2S,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-3-carbonyl fluoride |
| SMILES | Cc1cn([C@H]2C[C@H](C(=O)F)[C@@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H13FN2O5/c1-5-3-14(11(18)13-10(5)17)8-2-6(9(12)16)7(4-15)19-8/h3,6-8,15H,2,4H2,1H3,(H,13,17,18)/t6-,7+,8+/m0/s1 |
| InChIKey | CZARBVCRJPYACU-XLPZGREQSA-N |
| XLogP | -0.76 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|