C22H38IN5O — CID 111736342
3-(methoxymethyl)-N'-methyl-N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111736342) has the molecular formula C22H38IN5O and a molecular weight of 515.48 g/mol. Its IUPAC name is 3-(methoxymethyl)-N'-methyl-N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | 3-(methoxymethyl)-N'-methyl-N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111736342 |
| Molecular Formula | C22H38IN5O |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | 3-(methoxymethyl)-N'-methyl-N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCCCN1CCN(c2cccc(C)c2)CC1)N1CCC(COC)C1.I |
| InChI | InChI=1S/C22H37N5O.HI/c1-19-6-4-7-21(16-19)26-14-12-25(13-15-26)10-5-9-24-22(23-2)27-11-8-20(17-27)18-28-3;/h4,6-7,16,20H,5,8-15,17-18H2,1-3H3,(H,23,24);1H |
| InChIKey | XRMRKEDEUHSAPS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|