C22H37N5O — CID 111737653
3-(methoxymethyl)-N'-methyl-N-[4-(4-phenylpiperazin-1-yl)butyl]pyrrolidine-1-carboximidamide (PubChem CID 111737653) has the molecular formula C22H37N5O and a molecular weight of 387.57 g/mol. Its IUPAC name is 3-(methoxymethyl)-N'-methyl-N-[4-(4-phenylpiperazin-1-yl)butyl]pyrrolidine-1-carboximidamide.
| Compound Name | 3-(methoxymethyl)-N'-methyl-N-[4-(4-phenylpiperazin-1-yl)butyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111737653 |
| Molecular Formula | C22H37N5O |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.30 |
| IUPAC Name | 3-(methoxymethyl)-N'-methyl-N-[4-(4-phenylpiperazin-1-yl)butyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCCCCN1CCN(c2ccccc2)CC1)N1CCC(COC)C1 |
| InChI | InChI=1S/C22H37N5O/c1-23-22(27-13-10-20(18-27)19-28-2)24-11-6-7-12-25-14-16-26(17-15-25)21-8-4-3-5-9-21/h3-5,8-9,20H,6-7,10-19H2,1-2H3,(H,23,24) |
| InChIKey | WMYBEBMQWYYLOL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|