C22H34IN5 — CID 111742872
N-ethyl-N'-[2-methyl-2-(2-methylphenyl)propyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111742872) has the molecular formula C22H34IN5 and a molecular weight of 495.45 g/mol. Its IUPAC name is N-ethyl-N'-[2-methyl-2-(2-methylphenyl)propyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[2-methyl-2-(2-methylphenyl)propyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111742872 |
| Molecular Formula | C22H34IN5 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | N-ethyl-N'-[2-methyl-2-(2-methylphenyl)propyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)c1ccccc1C)N1CCC(c2cnn(C)c2)C1.I |
| InChI | InChI=1S/C22H33N5.HI/c1-6-23-21(24-16-22(3,4)20-10-8-7-9-17(20)2)27-12-11-18(15-27)19-13-25-26(5)14-19;/h7-10,13-14,18H,6,11-12,15-16H2,1-5H3,(H,23,24);1H |
| InChIKey | NNMUYDPPORECTI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|