C21H30ClN5 — CID 111743145
N'-[2-(4-chlorophenyl)-2-methylpropyl]-N-ethyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide (PubChem CID 111743145) has the molecular formula C21H30ClN5 and a molecular weight of 387.96 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)-2-methylpropyl]-N-ethyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-[2-(4-chlorophenyl)-2-methylpropyl]-N-ethyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111743145 |
| Molecular Formula | C21H30ClN5 |
| Molecular Weight | 387.96 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | N'-[2-(4-chlorophenyl)-2-methylpropyl]-N-ethyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(C)(C)c1ccc(Cl)cc1)N1CCC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C21H30ClN5/c1-5-23-20(24-15-21(2,3)18-6-8-19(22)9-7-18)27-11-10-16(14-27)17-12-25-26(4)13-17/h6-9,12-13,16H,5,10-11,14-15H2,1-4H3,(H,23,24) |
| InChIKey | XKYAYSYMITUOIT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.96 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|