C20H28ClN5 — CID 111742581
N-[2-(4-chlorophenyl)-2-methylpropyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide (PubChem CID 111742581) has the molecular formula C20H28ClN5 and a molecular weight of 373.93 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-methylpropyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide.
| Compound Name | N-[2-(4-chlorophenyl)-2-methylpropyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111742581 |
| Molecular Formula | C20H28ClN5 |
| Molecular Weight | 373.93 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-methylpropyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCC(C)(C)c1ccc(Cl)cc1)N1CCC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C20H28ClN5/c1-20(2,17-5-7-18(21)8-6-17)14-23-19(22-3)26-10-9-15(13-26)16-11-24-25(4)12-16/h5-8,11-12,15H,9-10,13-14H2,1-4H3,(H,22,23) |
| InChIKey | XEJJNTNYWJOBDR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.93 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|