C11H16Br2 — CID 11174290
(5S,7R)-2-bromo-1-(bromomethyl)adamantane (PubChem CID 11174290) has the molecular formula C11H16Br2 and a molecular weight of 308.06 g/mol. Its IUPAC name is (5S,7R)-2-bromo-1-(bromomethyl)adamantane.
| Compound Name | (5S,7R)-2-bromo-1-(bromomethyl)adamantane |
|---|---|
| PubChem CID | 11174290 |
| Molecular Formula | C11H16Br2 |
| Molecular Weight | 308.06 g/mol |
| Exact Mass | 305.96 |
| IUPAC Name | (5S,7R)-2-bromo-1-(bromomethyl)adamantane |
| SMILES | BrCC12C[C@@H]3CC(C[C@@H](C3)C1)C2Br |
| InChI | InChI=1S/C11H16Br2/c12-6-11-4-7-1-8(5-11)3-9(2-7)10(11)13/h7-10H,1-6H2/t7-,8+,9?,10?,11? |
| InChIKey | ZYEKTEHAZSXMHK-ZACHXXIVSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.06 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|