C21H27FN6 — CID 111743129
N-ethyl-N'-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide (PubChem CID 111743129) has the molecular formula C21H27FN6 and a molecular weight of 382.49 g/mol. Its IUPAC name is N-ethyl-N'-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111743129 |
| Molecular Formula | C21H27FN6 |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | N-ethyl-N'-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1c[nH]c2cc(F)ccc12)N1CCC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C21H27FN6/c1-3-23-21(28-9-7-16(14-28)17-12-26-27(2)13-17)24-8-6-15-11-25-20-10-18(22)4-5-19(15)20/h4-5,10-13,16,25H,3,6-9,14H2,1-2H3,(H,23,24) |
| InChIKey | RTGXTAADAFVTCL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 61.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|