C17H15N3OS — CID 11174333
3-(4-methoxyphenyl)-11-methyl-8-thia-3,4,10-triazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,10,12-pentaene (PubChem CID 11174333) has the molecular formula C17H15N3OS and a molecular weight of 309.39 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-11-methyl-8-thia-3,4,10-triazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,10,12-pentaene.
| Compound Name | 3-(4-methoxyphenyl)-11-methyl-8-thia-3,4,10-triazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,10,12-pentaene |
|---|---|
| PubChem CID | 11174333 |
| Molecular Formula | C17H15N3OS |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 3-(4-methoxyphenyl)-11-methyl-8-thia-3,4,10-triazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,10,12-pentaene |
| SMILES | COc1ccc(-n2ncc3c2-c2ccc(C)nc2SC3)cc1 |
| InChI | InChI=1S/C17H15N3OS/c1-11-3-8-15-16-12(10-22-17(15)19-11)9-18-20(16)13-4-6-14(21-2)7-5-13/h3-9H,10H2,1-2H3 |
| InChIKey | RXBVNCSPNFRJGO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |