C13H14N4O2 — CID 141413691
6-amino-1-(4-methoxyphenyl)-4,5-dihydropyrazolo[5,4-c]pyridin-7-one (PubChem CID 141413691) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is 6-amino-1-(4-methoxyphenyl)-4,5-dihydropyrazolo[5,4-c]pyridin-7-one.
| Compound Name | 6-amino-1-(4-methoxyphenyl)-4,5-dihydropyrazolo[5,4-c]pyridin-7-one |
|---|---|
| PubChem CID | 141413691 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 6-amino-1-(4-methoxyphenyl)-4,5-dihydropyrazolo[5,4-c]pyridin-7-one |
| SMILES | COc1ccc(-n2ncc3c2C(=O)N(N)CC3)cc1 |
| InChI | InChI=1S/C13H14N4O2/c1-19-11-4-2-10(3-5-11)17-12-9(8-15-17)6-7-16(14)13(12)18/h2-5,8H,6-7,14H2,1H3 |
| InChIKey | DNNMQHXSBXZZGP-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|