C16H30O4Si — CID 11174488
tert-butyl-[[(1S,2R,4S,5R,7S)-4-ethenyl-2-methoxy-6,8-dioxabicyclo[3.2.1]octan-7-yl]methoxy]-dimethylsilane (PubChem CID 11174488) has the molecular formula C16H30O4Si and a molecular weight of 314.50 g/mol. Its IUPAC name is tert-butyl-[[(1S,2R,4S,5R,7S)-4-ethenyl-2-methoxy-6,8-dioxabicyclo[3.2.1]octan-7-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,2R,4S,5R,7S)-4-ethenyl-2-methoxy-6,8-dioxabicyclo[3.2.1]octan-7-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11174488 |
| Molecular Formula | C16H30O4Si |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | tert-butyl-[[(1S,2R,4S,5R,7S)-4-ethenyl-2-methoxy-6,8-dioxabicyclo[3.2.1]octan-7-yl]methoxy]-dimethylsilane |
| SMILES | C=C[C@@H]1C[C@@H](OC)[C@@H]2O[C@H]1O[C@H]2CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H30O4Si/c1-8-11-9-12(17-5)14-13(19-15(11)20-14)10-18-21(6,7)16(2,3)4/h8,11-15H,1,9-10H2,2-7H3/t11-,12-,13+,14+,15-/m1/s1 |
| InChIKey | IBGLXKJOHGROML-NIFZNCRKSA-N |
| XLogP | 3.34 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|