C26H50O6Si — CID 11248764
(1S,2R)-1-[(3S,5R,7S,8R,9S,10S)-8-(methoxymethoxy)-9,10-dimethyl-3-tri(propan-2-yl)silyloxy-1,6-dioxaspiro[4.5]decan-7-yl]-2-methylbut-3-en-1-ol (PubChem CID 11248764) has the molecular formula C26H50O6Si and a molecular weight of 486.77 g/mol. Its IUPAC name is (1S,2R)-1-[(3S,5R,7S,8R,9S,10S)-8-(methoxymethoxy)-9,10-dimethyl-3-tri(propan-2-yl)silyloxy-1,6-dioxaspiro[4.5]decan-7-yl]-2-methylbut-3-en-1-ol.
| Compound Name | (1S,2R)-1-[(3S,5R,7S,8R,9S,10S)-8-(methoxymethoxy)-9,10-dimethyl-3-tri(propan-2-yl)silyloxy-1,6-dioxaspiro[4.5]decan-7-yl]-2-methylbut-3-en-1-ol |
|---|---|
| PubChem CID | 11248764 |
| Molecular Formula | C26H50O6Si |
| Molecular Weight | 486.77 g/mol |
| Exact Mass | 486.34 |
| IUPAC Name | (1S,2R)-1-[(3S,5R,7S,8R,9S,10S)-8-(methoxymethoxy)-9,10-dimethyl-3-tri(propan-2-yl)silyloxy-1,6-dioxaspiro[4.5]decan-7-yl]-2-methylbut-3-en-1-ol |
| SMILES | C=C[C@@H](C)[C@H](O)[C@@H]1O[C@]2(C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)CO2)[C@@H](C)[C@H](C)[C@H]1OCOC |
| InChI | InChI=1S/C26H50O6Si/c1-12-19(8)23(27)25-24(29-15-28-11)20(9)21(10)26(31-25)13-22(14-30-26)32-33(16(2)3,17(4)5)18(6)7/h12,16-25,27H,1,13-15H2,2-11H3/t19-,20+,21+,22+,23+,24-,25+,26-/m1/s1 |
| InChIKey | GOAQRZDGBPDTGK-OMQDSTFOSA-N |
| XLogP | 5.51 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.77 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|