C16H29IN6 — CID 111744931
N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-N'-methyl-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide (PubChem CID 111744931) has the molecular formula C16H29IN6 and a molecular weight of 432.35 g/mol. Its IUPAC name is N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-N'-methyl-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide.
| Compound Name | N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-N'-methyl-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111744931 |
| Molecular Formula | C16H29IN6 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-N'-methyl-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide |
| SMILES | CCn1cnnc1CN/C(=N\C)N1CCC2(CCCCC2)C1.I |
| InChI | InChI=1S/C16H28N6.HI/c1-3-21-13-19-20-14(21)11-18-15(17-2)22-10-9-16(12-22)7-5-4-6-8-16;/h13H,3-12H2,1-2H3,(H,17,18);1H |
| InChIKey | VBTGBTSYHBZSPN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|