C18H27N7 — CID 110960159
4-benzyl-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-N'-methylpiperazine-1-carboximidamide (PubChem CID 110960159) has the molecular formula C18H27N7 and a molecular weight of 341.46 g/mol. Its IUPAC name is 4-benzyl-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-benzyl-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110960159 |
| Molecular Formula | C18H27N7 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.23 |
| IUPAC Name | 4-benzyl-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-N'-methylpiperazine-1-carboximidamide |
| SMILES | CCn1cnnc1CN/C(=N\C)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H27N7/c1-3-24-15-21-22-17(24)13-20-18(19-2)25-11-9-23(10-12-25)14-16-7-5-4-6-8-16/h4-8,15H,3,9-14H2,1-2H3,(H,19,20) |
| InChIKey | IWRRSBHAIKVHLQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|