C19H34N4 — CID 111744934
N-[(1-cyclopropylpyrrolidin-3-yl)methyl]-N'-methyl-2-azaspiro[4.5]decane-2-carboximidamide (PubChem CID 111744934) has the molecular formula C19H34N4 and a molecular weight of 318.51 g/mol. Its IUPAC name is N-[(1-cyclopropylpyrrolidin-3-yl)methyl]-N'-methyl-2-azaspiro[4.5]decane-2-carboximidamide.
| Compound Name | N-[(1-cyclopropylpyrrolidin-3-yl)methyl]-N'-methyl-2-azaspiro[4.5]decane-2-carboximidamide |
|---|---|
| PubChem CID | 111744934 |
| Molecular Formula | C19H34N4 |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.28 |
| IUPAC Name | N-[(1-cyclopropylpyrrolidin-3-yl)methyl]-N'-methyl-2-azaspiro[4.5]decane-2-carboximidamide |
| SMILES | C/N=C(\NCC1CCN(C2CC2)C1)N1CCC2(CCCCC2)C1 |
| InChI | InChI=1S/C19H34N4/c1-20-18(21-13-16-7-11-22(14-16)17-5-6-17)23-12-10-19(15-23)8-3-2-4-9-19/h16-17H,2-15H2,1H3,(H,20,21) |
| InChIKey | DJCCABUXLKNHDM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|