C17H32N4O2S — CID 111733449
N'-methyl-N-[(1-methylsulfonylpiperidin-4-yl)methyl]-2-azaspiro[4.4]nonane-2-carboximidamide (PubChem CID 111733449) has the molecular formula C17H32N4O2S and a molecular weight of 356.54 g/mol. Its IUPAC name is N'-methyl-N-[(1-methylsulfonylpiperidin-4-yl)methyl]-2-azaspiro[4.4]nonane-2-carboximidamide.
| Compound Name | N'-methyl-N-[(1-methylsulfonylpiperidin-4-yl)methyl]-2-azaspiro[4.4]nonane-2-carboximidamide |
|---|---|
| PubChem CID | 111733449 |
| Molecular Formula | C17H32N4O2S |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | N'-methyl-N-[(1-methylsulfonylpiperidin-4-yl)methyl]-2-azaspiro[4.4]nonane-2-carboximidamide |
| SMILES | C/N=C(\NCC1CCN(S(C)(=O)=O)CC1)N1CCC2(CCCC2)C1 |
| InChI | InChI=1S/C17H32N4O2S/c1-18-16(20-12-9-17(14-20)7-3-4-8-17)19-13-15-5-10-21(11-6-15)24(2,22)23/h15H,3-14H2,1-2H3,(H,18,19) |
| InChIKey | DLWSFCJZVVMTOJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|