C12H10F3N3O2S — CID 11174547
1-(4-hydroxy-2-methylphenyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea (PubChem CID 11174547) has the molecular formula C12H10F3N3O2S and a molecular weight of 317.29 g/mol. Its IUPAC name is 1-(4-hydroxy-2-methylphenyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea.
| Compound Name | 1-(4-hydroxy-2-methylphenyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 11174547 |
| Molecular Formula | C12H10F3N3O2S |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 1-(4-hydroxy-2-methylphenyl)-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea |
| SMILES | Cc1cc(O)ccc1NC(=O)Nc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C12H10F3N3O2S/c1-6-4-7(19)2-3-8(6)16-10(20)18-11-17-9(5-21-11)12(13,14)15/h2-5,19H,1H3,(H2,16,17,18,20) |
| InChIKey | XNMAOIGJLOFEDE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|