C20H34N4O3 — CID 111746687
N-ethyl-N'-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide (PubChem CID 111746687) has the molecular formula C20H34N4O3 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-ethyl-N'-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111746687 |
| Molecular Formula | C20H34N4O3 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | N-ethyl-N'-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ncc(C)c(OC)c1C)N1CCC(COCCOC)C1 |
| InChI | InChI=1S/C20H34N4O3/c1-6-21-20(24-8-7-17(13-24)14-27-10-9-25-4)23-12-18-16(3)19(26-5)15(2)11-22-18/h11,17H,6-10,12-14H2,1-5H3,(H,21,23) |
| InChIKey | XYNRCUZJOJWXEO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 68.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|