C22H37N5O2 — CID 111747340
3-(2-methoxyethoxymethyl)-N'-methyl-N-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]pyrrolidine-1-carboximidamide (PubChem CID 111747340) has the molecular formula C22H37N5O2 and a molecular weight of 403.57 g/mol. Its IUPAC name is 3-(2-methoxyethoxymethyl)-N'-methyl-N-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]pyrrolidine-1-carboximidamide.
| Compound Name | 3-(2-methoxyethoxymethyl)-N'-methyl-N-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111747340 |
| Molecular Formula | C22H37N5O2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.29 |
| IUPAC Name | 3-(2-methoxyethoxymethyl)-N'-methyl-N-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(N2CCC(C)CC2)nc1)N1CCC(COCCOC)C1 |
| InChI | InChI=1S/C22H37N5O2/c1-18-6-9-26(10-7-18)21-5-4-19(14-24-21)15-25-22(23-2)27-11-8-20(16-27)17-29-13-12-28-3/h4-5,14,18,20H,6-13,15-17H2,1-3H3,(H,23,25) |
| InChIKey | BCYOBDQAYWDKBL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|