C19H36O2Si — CID 11174747
[(2Z,6S)-6,7-dimethyl-3-(trimethylsilylmethyl)octa-2,7-dienyl] 2,2-dimethylpropanoate (PubChem CID 11174747) has the molecular formula C19H36O2Si and a molecular weight of 324.58 g/mol. Its IUPAC name is [(2Z,6S)-6,7-dimethyl-3-(trimethylsilylmethyl)octa-2,7-dienyl] 2,2-dimethylpropanoate.
| Compound Name | [(2Z,6S)-6,7-dimethyl-3-(trimethylsilylmethyl)octa-2,7-dienyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11174747 |
| Molecular Formula | C19H36O2Si |
| Molecular Weight | 324.58 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | [(2Z,6S)-6,7-dimethyl-3-(trimethylsilylmethyl)octa-2,7-dienyl] 2,2-dimethylpropanoate |
| SMILES | C=C(C)[C@@H](C)CC/C(=C/COC(=O)C(C)(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C19H36O2Si/c1-15(2)16(3)10-11-17(14-22(7,8)9)12-13-21-18(20)19(4,5)6/h12,16H,1,10-11,13-14H2,2-9H3/b17-12-/t16-/m0/s1 |
| InChIKey | CUDLROGZIDLOTM-BQGMYUGNSA-N |
| XLogP | 5.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|