C19H34O2Si — CID 101274652
ethyl (Z)-3-(4-tert-butylcyclohexen-1-yl)-2-(trimethylsilylmethyl)prop-2-enoate (PubChem CID 101274652) has the molecular formula C19H34O2Si and a molecular weight of 322.57 g/mol. Its IUPAC name is ethyl (Z)-3-(4-tert-butylcyclohexen-1-yl)-2-(trimethylsilylmethyl)prop-2-enoate.
| Compound Name | ethyl (Z)-3-(4-tert-butylcyclohexen-1-yl)-2-(trimethylsilylmethyl)prop-2-enoate |
|---|---|
| PubChem CID | 101274652 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.57 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | ethyl (Z)-3-(4-tert-butylcyclohexen-1-yl)-2-(trimethylsilylmethyl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/C1=CCC(C(C)(C)C)CC1)C[Si](C)(C)C |
| InChI | InChI=1S/C19H34O2Si/c1-8-21-18(20)16(14-22(5,6)7)13-15-9-11-17(12-10-15)19(2,3)4/h9,13,17H,8,10-12,14H2,1-7H3/b16-13+ |
| InChIKey | REAPQILWCXDVIK-DTQAZKPQSA-N |
| XLogP | 5.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.57 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|