C23H40N4O2 — CID 111748594
N'-[[3-(diethylaminomethyl)phenyl]methyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide (PubChem CID 111748594) has the molecular formula C23H40N4O2 and a molecular weight of 404.60 g/mol. Its IUPAC name is N'-[[3-(diethylaminomethyl)phenyl]methyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-[[3-(diethylaminomethyl)phenyl]methyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111748594 |
| Molecular Formula | C23H40N4O2 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.32 |
| IUPAC Name | N'-[[3-(diethylaminomethyl)phenyl]methyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cccc(CN(CC)CC)c1)N1CCC(COCCOC)C1 |
| InChI | InChI=1S/C23H40N4O2/c1-5-24-23(27-12-11-22(18-27)19-29-14-13-28-4)25-16-20-9-8-10-21(15-20)17-26(6-2)7-3/h8-10,15,22H,5-7,11-14,16-19H2,1-4H3,(H,24,25) |
| InChIKey | CIBPFFQIYHOGMX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|