C19H24FN3O2 — CID 111751057
1-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]-3-[[2-(hydroxymethyl)phenyl]methyl]urea (PubChem CID 111751057) has the molecular formula C19H24FN3O2 and a molecular weight of 345.42 g/mol. Its IUPAC name is 1-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]-3-[[2-(hydroxymethyl)phenyl]methyl]urea.
| Compound Name | 1-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]-3-[[2-(hydroxymethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 111751057 |
| Molecular Formula | C19H24FN3O2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 1-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]-3-[[2-(hydroxymethyl)phenyl]methyl]urea |
| SMILES | CN(CCNC(=O)NCc1ccccc1CO)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C19H24FN3O2/c1-23(13-15-6-8-18(20)9-7-15)11-10-21-19(25)22-12-16-4-2-3-5-17(16)14-24/h2-9,24H,10-14H2,1H3,(H2,21,22,25) |
| InChIKey | YTVFPPLXGGKUSB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |