C13H21FN4O3S — CID 154749821
1-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]-3-(2-sulfamoylethyl)urea (PubChem CID 154749821) has the molecular formula C13H21FN4O3S and a molecular weight of 332.40 g/mol. Its IUPAC name is 1-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]-3-(2-sulfamoylethyl)urea.
| Compound Name | 1-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]-3-(2-sulfamoylethyl)urea |
|---|---|
| PubChem CID | 154749821 |
| Molecular Formula | C13H21FN4O3S |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]-3-(2-sulfamoylethyl)urea |
| SMILES | CN(CCNC(=O)NCCS(N)(=O)=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C13H21FN4O3S/c1-18(10-11-2-4-12(14)5-3-11)8-6-16-13(19)17-7-9-22(15,20)21/h2-5H,6-10H2,1H3,(H2,15,20,21)(H2,16,17,19) |
| InChIKey | JLSLSCZFDSIPMU-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |