C20H27BrIN3O3 — CID 111752735
2-[2-(2-bromophenoxy)propyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111752735) has the molecular formula C20H27BrIN3O3 and a molecular weight of 564.26 g/mol. Its IUPAC name is 2-[2-(2-bromophenoxy)propyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(2-bromophenoxy)propyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111752735 |
| Molecular Formula | C20H27BrIN3O3 |
| Molecular Weight | 564.26 g/mol |
| Exact Mass | 563.03 |
| IUPAC Name | 2-[2-(2-bromophenoxy)propyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | COc1ccc(CCN/C(N)=N/CC(C)Oc2ccccc2Br)cc1OC.I |
| InChI | InChI=1S/C20H26BrN3O3.HI/c1-14(27-17-7-5-4-6-16(17)21)13-24-20(22)23-11-10-15-8-9-18(25-2)19(12-15)26-3;/h4-9,12,14H,10-11,13H2,1-3H3,(H3,22,23,24);1H |
| InChIKey | BYOVNHWYKXGHHX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|