C22H30IN5O3 — CID 111754068
N-tert-butyl-2-[[N'-[(4-nitrophenyl)methyl]-N-(1-phenylethyl)carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111754068) has the molecular formula C22H30IN5O3 and a molecular weight of 539.42 g/mol. Its IUPAC name is N-tert-butyl-2-[[N'-[(4-nitrophenyl)methyl]-N-(1-phenylethyl)carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[N'-[(4-nitrophenyl)methyl]-N-(1-phenylethyl)carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111754068 |
| Molecular Formula | C22H30IN5O3 |
| Molecular Weight | 539.42 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | N-tert-butyl-2-[[N'-[(4-nitrophenyl)methyl]-N-(1-phenylethyl)carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | CC(N/C(=N/Cc1ccc([N+](=O)[O-])cc1)NCC(=O)NC(C)(C)C)c1ccccc1.I |
| InChI | InChI=1S/C22H29N5O3.HI/c1-16(18-8-6-5-7-9-18)25-21(24-15-20(28)26-22(2,3)4)23-14-17-10-12-19(13-11-17)27(29)30;/h5-13,16H,14-15H2,1-4H3,(H,26,28)(H2,23,24,25);1H |
| InChIKey | IRJSFZPGOLMKGR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 108.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|