C14H20N4O4 — CID 87034642
N-tert-butyl-2-[(4-nitrophenyl)methylcarbamoylamino]acetamide (PubChem CID 87034642) has the molecular formula C14H20N4O4 and a molecular weight of 308.34 g/mol. Its IUPAC name is N-tert-butyl-2-[(4-nitrophenyl)methylcarbamoylamino]acetamide.
| Compound Name | N-tert-butyl-2-[(4-nitrophenyl)methylcarbamoylamino]acetamide |
|---|---|
| PubChem CID | 87034642 |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | N-tert-butyl-2-[(4-nitrophenyl)methylcarbamoylamino]acetamide |
| SMILES | CC(C)(C)NC(=O)CNC(=O)NCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H20N4O4/c1-14(2,3)17-12(19)9-16-13(20)15-8-10-4-6-11(7-5-10)18(21)22/h4-7H,8-9H2,1-3H3,(H,17,19)(H2,15,16,20) |
| InChIKey | IPLRHLRRJSPQFK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|