C16H20N4O6 — CID 119349300
1-[2-[(4-nitrophenyl)methylcarbamoylamino]acetyl]piperidine-4-carboxylic acid (PubChem CID 119349300) has the molecular formula C16H20N4O6 and a molecular weight of 364.36 g/mol. Its IUPAC name is 1-[2-[(4-nitrophenyl)methylcarbamoylamino]acetyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-[(4-nitrophenyl)methylcarbamoylamino]acetyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119349300 |
| Molecular Formula | C16H20N4O6 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 1-[2-[(4-nitrophenyl)methylcarbamoylamino]acetyl]piperidine-4-carboxylic acid |
| SMILES | O=C(NCC(=O)N1CCC(C(=O)O)CC1)NCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H20N4O6/c21-14(19-7-5-12(6-8-19)15(22)23)10-18-16(24)17-9-11-1-3-13(4-2-11)20(25)26/h1-4,12H,5-10H2,(H,22,23)(H2,17,18,24) |
| InChIKey | ZBRKGHWPPLZBRU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 141.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|