C15H19N3O2S — CID 111754482
1-(4-hydroxy-2-methylbutan-2-yl)-3-[4-(1,3-thiazol-2-yl)phenyl]urea (PubChem CID 111754482) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 1-(4-hydroxy-2-methylbutan-2-yl)-3-[4-(1,3-thiazol-2-yl)phenyl]urea.
| Compound Name | 1-(4-hydroxy-2-methylbutan-2-yl)-3-[4-(1,3-thiazol-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 111754482 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 1-(4-hydroxy-2-methylbutan-2-yl)-3-[4-(1,3-thiazol-2-yl)phenyl]urea |
| SMILES | CC(C)(CCO)NC(=O)Nc1ccc(-c2nccs2)cc1 |
| InChI | InChI=1S/C15H19N3O2S/c1-15(2,7-9-19)18-14(20)17-12-5-3-11(4-6-12)13-16-8-10-21-13/h3-6,8,10,19H,7,9H2,1-2H3,(H2,17,18,20) |
| InChIKey | QTYFZMZVWQEVJZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |