About N-(5-hydroxy-4,4-dimethylpentyl)-2-(3-methoxyphenyl)pyrrolidine-1-carboxamide
N-(5-hydroxy-4,4-dimethylpentyl)-2-(3-methoxyphenyl)pyrrolidine-1-carboxamide (PubChem CID 111755058) has the molecular formula C19H30N2O3
and a molecular weight of 334.46 g/mol. Its IUPAC name is N-(5-hydroxy-4,4-dimethylpentyl)-2-(3-methoxyphenyl)pyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | N-(5-hydroxy-4,4-dimethylpentyl)-2-(3-methoxyphenyl)pyrrolidine-1-carboxamide |
| PubChem CID | 111755058 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | N-(5-hydroxy-4,4-dimethylpentyl)-2-(3-methoxyphenyl)pyrrolidine-1-carboxamide |
| SMILES | COc1cccc(C2CCCN2C(=O)NCCCC(C)(C)CO)c1 |
| InChI | InChI=1S/C19H30N2O3/c1-19(2,14-22)10-6-11-20-18(23)21-12-5-9-17(21)15-7-4-8-16(13-15)24-3/h4,7-8,13,17,22H,5-6,9-12,14H2,1-3H3,(H,20,23) |
| InChIKey | QKSDMLLGTACMOK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(5-hydroxy-4,4-dimethylpentyl)-2-(3-methoxyphenyl)pyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-hydroxy-4,4-dimethylpentyl)-2-(3-methoxyphenyl)pyrrolidine-1-carboxamide?
The IUPAC name of N-(5-hydroxy-4,4-dimethylpentyl)-2-(3-methoxyphenyl)pyrrolidine-1-carboxamide (CID 111755058) is N-(5-hydroxy-4,4-dimethylpentyl)-2-(3-methoxyphenyl)pyrrolidine-1-carboxamide.
What is the SMILES notation for N-(5-hydroxy-4,4-dimethylpentyl)-2-(3-methoxyphenyl)pyrrolidine-1-carboxamide?
The canonical SMILES for N-(5-hydroxy-4,4-dimethylpentyl)-2-(3-methoxyphenyl)pyrrolidine-1-carboxamide is COc1cccc(C2CCCN2C(=O)NCCCC(C)(C)CO)c1.
What is the InChIKey of N-(5-hydroxy-4,4-dimethylpentyl)-2-(3-methoxyphenyl)pyrrolidine-1-carboxamide?
The InChIKey is QKSDMLLGTACMOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2O3/c1-19(2,14-22)10-6-11-20-18(23)21-12-5-9-17(21)15-7-4-8-16(13-15)24-3/h4,7-8,13,17,22H,5-6,9-12,14H2,1-3H3,(H,20,23).
What are the key properties of N-(5-hydroxy-4,4-dimethylpentyl)-2-(3-methoxyphenyl)pyrrolidine-1-carboxamide?
N-(5-hydroxy-4,4-dimethylpentyl)-2-(3-methoxyphenyl)pyrrolidine-1-carboxamide has a molecular weight of 334.46 g/mol, XLogP of 3.34, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-hydroxy-4,4-dimethylpentyl)-2-(3-methoxyphenyl)pyrrolidine-1-carboxamide is sourced from PubChem (CID 111755058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).