C21H35IN4O2 — CID 111756133
1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine;hydroiodide (PubChem CID 111756133) has the molecular formula C21H35IN4O2 and a molecular weight of 502.44 g/mol. Its IUPAC name is 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111756133 |
| Molecular Formula | C21H35IN4O2 |
| Molecular Weight | 502.44 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC(c1ccco1)N1CCCCC1)NC1C2CCOC2C1(C)C.I |
| InChI | InChI=1S/C21H34N4O2.HI/c1-21(2)18(15-9-13-27-19(15)21)24-20(22-3)23-14-16(17-8-7-12-26-17)25-10-5-4-6-11-25;/h7-8,12,15-16,18-19H,4-6,9-11,13-14H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | PHYXVRSSLBBUBZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 62.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|