C18H34IN3O2 — CID 119155564
1-(2-cyclohexyl-2-hydroxyethyl)-3-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methylguanidine;hydroiodide (PubChem CID 119155564) has the molecular formula C18H34IN3O2 and a molecular weight of 451.39 g/mol. Its IUPAC name is 1-(2-cyclohexyl-2-hydroxyethyl)-3-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-(2-cyclohexyl-2-hydroxyethyl)-3-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119155564 |
| Molecular Formula | C18H34IN3O2 |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 1-(2-cyclohexyl-2-hydroxyethyl)-3-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC(O)C1CCCCC1)NC1C2CCOC2C1(C)C.I |
| InChI | InChI=1S/C18H33N3O2.HI/c1-18(2)15(13-9-10-23-16(13)18)21-17(19-3)20-11-14(22)12-7-5-4-6-8-12;/h12-16,22H,4-11H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | ICFQFOYONKCXIU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|