C15H30IN3O — CID 111755885
1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methyl-3-(3-methylbutyl)guanidine;hydroiodide (PubChem CID 111755885) has the molecular formula C15H30IN3O and a molecular weight of 395.33 g/mol. Its IUPAC name is 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methyl-3-(3-methylbutyl)guanidine;hydroiodide.
| Compound Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methyl-3-(3-methylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111755885 |
| Molecular Formula | C15H30IN3O |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methyl-3-(3-methylbutyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(C)C)NC1C2CCOC2C1(C)C.I |
| InChI | InChI=1S/C15H29N3O.HI/c1-10(2)6-8-17-14(16-5)18-12-11-7-9-19-13(11)15(12,3)4;/h10-13H,6-9H2,1-5H3,(H2,16,17,18);1H |
| InChIKey | DKLKFCRHDKCYSU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|