C16H28IN5O2 — CID 119153120
1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[2-(5-ethyl-1,2,4-oxadiazol-3-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 119153120) has the molecular formula C16H28IN5O2 and a molecular weight of 449.34 g/mol. Its IUPAC name is 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[2-(5-ethyl-1,2,4-oxadiazol-3-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[2-(5-ethyl-1,2,4-oxadiazol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119153120 |
| Molecular Formula | C16H28IN5O2 |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[2-(5-ethyl-1,2,4-oxadiazol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1nc(CCN/C(=N\C)NC2C3CCOC3C2(C)C)no1.I |
| InChI | InChI=1S/C16H27N5O2.HI/c1-5-12-19-11(21-23-12)6-8-18-15(17-4)20-13-10-7-9-22-14(10)16(13,2)3;/h10,13-14H,5-9H2,1-4H3,(H2,17,18,20);1H |
| InChIKey | JWWRSUNINCWDAI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|