C17H25F3N4OS — CID 119157561
1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine (PubChem CID 119157561) has the molecular formula C17H25F3N4OS and a molecular weight of 390.48 g/mol. Its IUPAC name is 1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine.
| Compound Name | 1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 119157561 |
| Molecular Formula | C17H25F3N4OS |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
| SMILES | C/N=C(\NCCc1nc(C(F)(F)F)cs1)NC1C2CCCOC2C1(C)C |
| InChI | InChI=1S/C17H25F3N4OS/c1-16(2)13(10-5-4-8-25-14(10)16)24-15(21-3)22-7-6-12-23-11(9-26-12)17(18,19)20/h9-10,13-14H,4-8H2,1-3H3,(H2,21,22,24) |
| InChIKey | SERMMEZFIYCZEP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|