C20H30N4O3 — CID 119154556
N-[2-[[N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-N'-methylcarbamimidoyl]amino]ethyl]-4-hydroxybenzamide (PubChem CID 119154556) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is N-[2-[[N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-N'-methylcarbamimidoyl]amino]ethyl]-4-hydroxybenzamide.
| Compound Name | N-[2-[[N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-N'-methylcarbamimidoyl]amino]ethyl]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 119154556 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | N-[2-[[N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-N'-methylcarbamimidoyl]amino]ethyl]-4-hydroxybenzamide |
| SMILES | C/N=C(\NCCNC(=O)c1ccc(O)cc1)NC1C2CCCOC2C1(C)C |
| InChI | InChI=1S/C20H30N4O3/c1-20(2)16(15-5-4-12-27-17(15)20)24-19(21-3)23-11-10-22-18(26)13-6-8-14(25)9-7-13/h6-9,15-17,25H,4-5,10-12H2,1-3H3,(H,22,26)(H2,21,23,24) |
| InChIKey | ZFIJFDXIZWSVCM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|