C17H29N5O — CID 119159120
1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-2-methyl-3-[2-(4-methylpyrazol-1-yl)ethyl]guanidine (PubChem CID 119159120) has the molecular formula C17H29N5O and a molecular weight of 319.45 g/mol. Its IUPAC name is 1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-2-methyl-3-[2-(4-methylpyrazol-1-yl)ethyl]guanidine.
| Compound Name | 1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-2-methyl-3-[2-(4-methylpyrazol-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 119159120 |
| Molecular Formula | C17H29N5O |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | 1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-2-methyl-3-[2-(4-methylpyrazol-1-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCCn1cc(C)cn1)NC1C2CCCOC2C1(C)C |
| InChI | InChI=1S/C17H29N5O/c1-12-10-20-22(11-12)8-7-19-16(18-4)21-14-13-6-5-9-23-15(13)17(14,2)3/h10-11,13-15H,5-9H2,1-4H3,(H2,18,19,21) |
| InChIKey | VUTXTPIENJACOO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|