C17H29N5O2 — CID 119161754
1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-methylguanidine (PubChem CID 119161754) has the molecular formula C17H29N5O2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-methylguanidine.
| Compound Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 119161754 |
| Molecular Formula | C17H29N5O2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-methylguanidine |
| SMILES | C/N=C(\NCC(C)(O)c1cnn(C)c1)NC1C2CCOC2C1(C)C |
| InChI | InChI=1S/C17H29N5O2/c1-16(2)13(12-6-7-24-14(12)16)21-15(18-4)19-10-17(3,23)11-8-20-22(5)9-11/h8-9,12-14,23H,6-7,10H2,1-5H3,(H2,18,19,21) |
| InChIKey | DBFHHHGDXSOKON-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|