C19H28FN3OS — CID 111756144
1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-methylguanidine (PubChem CID 111756144) has the molecular formula C19H28FN3OS and a molecular weight of 365.52 g/mol. Its IUPAC name is 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-methylguanidine.
| Compound Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111756144 |
| Molecular Formula | C19H28FN3OS |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCSc1ccc(F)cc1)NC1C2CCOC2C1(C)C |
| InChI | InChI=1S/C19H28FN3OS/c1-19(2)16(15-9-11-24-17(15)19)23-18(21-3)22-10-4-12-25-14-7-5-13(20)6-8-14/h5-8,15-17H,4,9-12H2,1-3H3,(H2,21,22,23) |
| InChIKey | HZAHEWASBQOTDK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|