C19H36IN3O2 — CID 111756321
1-(3-cyclohexyloxypropyl)-3-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methylguanidine;hydroiodide (PubChem CID 111756321) has the molecular formula C19H36IN3O2 and a molecular weight of 465.42 g/mol. Its IUPAC name is 1-(3-cyclohexyloxypropyl)-3-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-(3-cyclohexyloxypropyl)-3-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111756321 |
| Molecular Formula | C19H36IN3O2 |
| Molecular Weight | 465.42 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 1-(3-cyclohexyloxypropyl)-3-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOC1CCCCC1)NC1C2CCOC2C1(C)C.I |
| InChI | InChI=1S/C19H35N3O2.HI/c1-19(2)16(15-10-13-24-17(15)19)22-18(20-3)21-11-7-12-23-14-8-5-4-6-9-14;/h14-17H,4-13H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | WGJWFDQLUGKPTJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|