C18H31F3IN3O — CID 119162783
1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methyl-3-[[2-(trifluoromethyl)cyclohexyl]methyl]guanidine;hydroiodide (PubChem CID 119162783) has the molecular formula C18H31F3IN3O and a molecular weight of 489.36 g/mol. Its IUPAC name is 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methyl-3-[[2-(trifluoromethyl)cyclohexyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methyl-3-[[2-(trifluoromethyl)cyclohexyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119162783 |
| Molecular Formula | C18H31F3IN3O |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2-methyl-3-[[2-(trifluoromethyl)cyclohexyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CCCCC1C(F)(F)F)NC1C2CCOC2C1(C)C.I |
| InChI | InChI=1S/C18H30F3N3O.HI/c1-17(2)14(12-8-9-25-15(12)17)24-16(22-3)23-10-11-6-4-5-7-13(11)18(19,20)21;/h11-15H,4-10H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | DJRHTUFHJWVCSU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|