C18H36IN3O2 — CID 119156705
1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine;hydroiodide (PubChem CID 119156705) has the molecular formula C18H36IN3O2 and a molecular weight of 453.41 g/mol. Its IUPAC name is 1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119156705 |
| Molecular Formula | C18H36IN3O2 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-3-(2-methoxy-3,3-dimethylbutyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC(OC)C(C)(C)C)NC1C2CCCOC2C1(C)C.I |
| InChI | InChI=1S/C18H35N3O2.HI/c1-17(2,3)13(22-7)11-20-16(19-6)21-14-12-9-8-10-23-15(12)18(14,4)5;/h12-15H,8-11H2,1-7H3,(H2,19,20,21);1H |
| InChIKey | CKNMGYFHZCXEPT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|