C18H34N4O2 — CID 119145738
1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-2-methyl-3-(2-morpholin-4-ylpropyl)guanidine (PubChem CID 119145738) has the molecular formula C18H34N4O2 and a molecular weight of 338.50 g/mol. Its IUPAC name is 1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-2-methyl-3-(2-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-2-methyl-3-(2-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 119145738 |
| Molecular Formula | C18H34N4O2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.27 |
| IUPAC Name | 1-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-2-methyl-3-(2-morpholin-4-ylpropyl)guanidine |
| SMILES | C/N=C(\NCC(C)N1CCOCC1)NC1C2CCCOC2C1(C)C |
| InChI | InChI=1S/C18H34N4O2/c1-13(22-7-10-23-11-8-22)12-20-17(19-4)21-15-14-6-5-9-24-16(14)18(15,2)3/h13-16H,5-12H2,1-4H3,(H2,19,20,21) |
| InChIKey | ZJKDFXCSNSGWTR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|